C25H31BrNO7P — CID 139298603
cyclohexyl (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 139298603) has the molecular formula C25H31BrNO7P and a molecular weight of 568.40 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | cyclohexyl (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 139298603 |
| Molecular Formula | C25H31BrNO7P |
| Molecular Weight | 568.40 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | cyclohexyl (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | O=C(OC1CCCCC1)[C@H](Cc1ccccc1)NP(=O)(OCC1OCCO1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H31BrNO7P/c26-20-11-13-22(14-12-20)34-35(29,32-18-24-30-15-16-31-24)27-23(17-19-7-3-1-4-8-19)25(28)33-21-9-5-2-6-10-21/h1,3-4,7-8,11-14,21,23-24H,2,5-6,9-10,15-18H2,(H,27,29)/t23-,35?/m0/s1 |
| InChIKey | XPLHLTXAFACCMZ-MYJVBWMHSA-N |
| XLogP | 5.40 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|