C17H25BrNO7P — CID 130437779
[(2R)-butan-2-yl] (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]propanoate (PubChem CID 130437779) has the molecular formula C17H25BrNO7P and a molecular weight of 466.27 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]propanoate.
| Compound Name | [(2R)-butan-2-yl] (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130437779 |
| Molecular Formula | C17H25BrNO7P |
| Molecular Weight | 466.27 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [(2R)-butan-2-yl] (2S)-2-[[(4-bromophenoxy)-(1,3-dioxolan-2-ylmethoxy)phosphoryl]amino]propanoate |
| SMILES | CC[C@@H](C)OC(=O)[C@H](C)NP(=O)(OCC1OCCO1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H25BrNO7P/c1-4-12(2)25-17(20)13(3)19-27(21,24-11-16-22-9-10-23-16)26-15-7-5-14(18)6-8-15/h5-8,12-13,16H,4,9-11H2,1-3H3,(H,19,21)/t12-,13+,27?/m1/s1 |
| InChIKey | ATGNCZSURLTYKS-PVJHXEPZSA-N |
| XLogP | 3.65 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|