C24H27N2O5P — CID 168980703
propan-2-yl 2-[[(7-carbamoylnaphthalen-2-yl)methyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 168980703) has the molecular formula C24H27N2O5P and a molecular weight of 454.46 g/mol. Its IUPAC name is propan-2-yl 2-[[(7-carbamoylnaphthalen-2-yl)methyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[(7-carbamoylnaphthalen-2-yl)methyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 168980703 |
| Molecular Formula | C24H27N2O5P |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | propan-2-yl 2-[[(7-carbamoylnaphthalen-2-yl)methyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(Cc1ccc2ccc(C(N)=O)cc2c1)Oc1ccccc1 |
| InChI | InChI=1S/C24H27N2O5P/c1-16(2)30-24(28)17(3)26-32(29,31-22-7-5-4-6-8-22)15-18-9-10-19-11-12-20(23(25)27)14-21(19)13-18/h4-14,16-17H,15H2,1-3H3,(H2,25,27)(H,26,29) |
| InChIKey | OUCXJZXWSIPOOO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|