C19H19N3O3S — CID 59519167
ethyl 2-amino-4-(2-methyl-4-prop-2-enoxyphenyl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 59519167) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is ethyl 2-amino-4-(2-methyl-4-prop-2-enoxyphenyl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-amino-4-(2-methyl-4-prop-2-enoxyphenyl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 59519167 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | ethyl 2-amino-4-(2-methyl-4-prop-2-enoxyphenyl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=CCOc1ccc(-c2nc(N)nc3sc(C(=O)OCC)cc23)c(C)c1 |
| InChI | InChI=1S/C19H19N3O3S/c1-4-8-25-12-6-7-13(11(3)9-12)16-14-10-15(18(23)24-5-2)26-17(14)22-19(20)21-16/h4,6-7,9-10H,1,5,8H2,2-3H3,(H2,20,21,22) |
| InChIKey | LJSLDEUYBBZOIO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|