C15H20N2O3S — CID 173285248
tert-butyl N-(6-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboximidoyl)carbamate (PubChem CID 173285248) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is tert-butyl N-(6-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboximidoyl)carbamate.
| Compound Name | tert-butyl N-(6-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboximidoyl)carbamate |
|---|---|
| PubChem CID | 173285248 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | tert-butyl N-(6-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboximidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1cc2c(s1)CC(C=O)CC2 |
| InChI | InChI=1S/C15H20N2O3S/c1-15(2,3)20-14(19)17-13(16)12-7-10-5-4-9(8-18)6-11(10)21-12/h7-9H,4-6H2,1-3H3,(H2,16,17,19) |
| InChIKey | VOONYMORNCKWTN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|