C22H32N2O6 — CID 168891556
tert-butyl 2-(6-methanimidoyl-3,4-dihydro-2H-chromen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate (PubChem CID 168891556) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl 2-(6-methanimidoyl-3,4-dihydro-2H-chromen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate.
| Compound Name | tert-butyl 2-(6-methanimidoyl-3,4-dihydro-2H-chromen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate |
|---|---|
| PubChem CID | 168891556 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | tert-butyl 2-(6-methanimidoyl-3,4-dihydro-2H-chromen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate |
| SMILES | [H]/N=C/c1ccc2c(c1)CCC(C(C)(ONC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)O2 |
| InChI | InChI=1S/C22H32N2O6/c1-20(2,3)28-18(25)22(7,30-24-19(26)29-21(4,5)6)17-11-9-15-12-14(13-23)8-10-16(15)27-17/h8,10,12-13,17,23H,9,11H2,1-7H3,(H,24,26)/b23-13+ |
| InChIKey | DFMYCQKVSJXTRX-YDZHTSKRSA-N |
| XLogP | 3.93 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|