C31H44N4O8 — CID 142554446
tert-butyl (2S)-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enoxycarbonylamino)oxypropanoate (PubChem CID 142554446) has the molecular formula C31H44N4O8 and a molecular weight of 600.71 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enoxycarbonylamino)oxypropanoate.
| Compound Name | tert-butyl (2S)-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enoxycarbonylamino)oxypropanoate |
|---|---|
| PubChem CID | 142554446 |
| Molecular Formula | C31H44N4O8 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enoxycarbonylamino)oxypropanoate |
| SMILES | C=CCOC(=O)NO[C@](C)(C(=O)OC(C)(C)C)[C@H]1CCc2cc(-c3cnn(CCCNC(=O)OC(C)(C)C)c3)ccc2O1 |
| InChI | InChI=1S/C31H44N4O8/c1-9-17-39-28(38)34-43-31(8,26(36)41-29(2,3)4)25-14-12-22-18-21(11-13-24(22)40-25)23-19-33-35(20-23)16-10-15-32-27(37)42-30(5,6)7/h9,11,13,18-20,25H,1,10,12,14-17H2,2-8H3,(H,32,37)(H,34,38)/t25-,31+/m1/s1 |
| InChIKey | BAOZUUKRBDKRGR-NJHZRGNWSA-N |
| XLogP | 5.10 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|