C13H19BrN4O3 — CID 147687106
tert-butyl N-[5-(3-bromopropoxy)pyrazine-2-carboximidoyl]carbamate (PubChem CID 147687106) has the molecular formula C13H19BrN4O3 and a molecular weight of 359.22 g/mol. Its IUPAC name is tert-butyl N-[5-(3-bromopropoxy)pyrazine-2-carboximidoyl]carbamate.
| Compound Name | tert-butyl N-[5-(3-bromopropoxy)pyrazine-2-carboximidoyl]carbamate |
|---|---|
| PubChem CID | 147687106 |
| Molecular Formula | C13H19BrN4O3 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | tert-butyl N-[5-(3-bromopropoxy)pyrazine-2-carboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1cnc(OCCCBr)cn1 |
| InChI | InChI=1S/C13H19BrN4O3/c1-13(2,3)21-12(19)18-11(15)9-7-17-10(8-16-9)20-6-4-5-14/h7-8H,4-6H2,1-3H3,(H2,15,18,19) |
| InChIKey | GQGDQMYDGAJPHW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|