C35H60N6O7 — CID 144860217
tert-butyl N-[3-[4-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]butoxy]benzenecarboximidoyl]carbamate (PubChem CID 144860217) has the molecular formula C35H60N6O7 and a molecular weight of 676.90 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]butoxy]benzenecarboximidoyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]butoxy]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 144860217 |
| Molecular Formula | C35H60N6O7 |
| Molecular Weight | 676.90 g/mol |
| Exact Mass | 676.45 |
| IUPAC Name | tert-butyl N-[3-[4-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]butoxy]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1cccc(OCCCCNCCCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C35H60N6O7/c1-33(2,3)46-30(42)39-28(36)26-19-18-20-27(25-26)45-24-17-16-22-37-21-14-12-10-11-13-15-23-38-29(40-31(43)47-34(4,5)6)41-32(44)48-35(7,8)9/h18-20,25,37H,10-17,21-24H2,1-9H3,(H2,36,39,42)(H2,38,40,41,43,44) |
| InChIKey | JEZGPBKBXIGHJL-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 172.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|