C29H48N6O6 — CID 118151631
tert-butyl N-[N'-[7-[4-[(3-amino-1,2-benzoxazol-6-yl)oxy]butylamino]heptyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 118151631) has the molecular formula C29H48N6O6 and a molecular weight of 576.74 g/mol. Its IUPAC name is tert-butyl N-[N'-[7-[4-[(3-amino-1,2-benzoxazol-6-yl)oxy]butylamino]heptyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[7-[4-[(3-amino-1,2-benzoxazol-6-yl)oxy]butylamino]heptyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 118151631 |
| Molecular Formula | C29H48N6O6 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | tert-butyl N-[N'-[7-[4-[(3-amino-1,2-benzoxazol-6-yl)oxy]butylamino]heptyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCCNCCCCOc1ccc2c(N)noc2c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H48N6O6/c1-28(2,3)39-26(36)33-25(34-27(37)40-29(4,5)6)32-18-11-9-7-8-10-16-31-17-12-13-19-38-21-14-15-22-23(20-21)41-35-24(22)30/h14-15,20,31H,7-13,16-19H2,1-6H3,(H2,30,35)(H2,32,33,34,36,37) |
| InChIKey | ZMYOUSJAKYBUTK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 162.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|