C13H16N2O2 — CID 174419990
tert-butyl N-(5-prop-1-ynyl-2-pyridinyl)carbamate (PubChem CID 174419990) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl N-(5-prop-1-ynyl-2-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(5-prop-1-ynyl-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 174419990 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | tert-butyl N-(5-prop-1-ynyl-2-pyridinyl)carbamate |
| SMILES | CC#Cc1ccc(NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C13H16N2O2/c1-5-6-10-7-8-11(14-9-10)15-12(16)17-13(2,3)4/h7-9H,1-4H3,(H,14,15,16) |
| InChIKey | GJVUQMZCFKQYNU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|