C11H18N3O2+ — CID 42553117
[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylazanium (PubChem CID 42553117) has the molecular formula C11H18N3O2+ and a molecular weight of 224.28 g/mol. Its IUPAC name is [6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylazanium.
| Compound Name | [6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylazanium |
|---|---|
| PubChem CID | 42553117 |
| Molecular Formula | C11H18N3O2+ |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | [6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methylazanium |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C[NH3+])cn1 |
| InChI | InChI=1S/C11H17N3O2/c1-11(2,3)16-10(15)14-9-5-4-8(6-12)7-13-9/h4-5,7H,6,12H2,1-3H3,(H,13,14,15)/p+1 |
| InChIKey | DFLQTVPEIMTXSZ-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |