C14H20N2O4 — CID 145262519
tert-butyl N-(5-cyclopropyl-2-pyridinyl)carbamate;formic acid (PubChem CID 145262519) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is tert-butyl N-(5-cyclopropyl-2-pyridinyl)carbamate;formic acid.
| Compound Name | tert-butyl N-(5-cyclopropyl-2-pyridinyl)carbamate;formic acid |
|---|---|
| PubChem CID | 145262519 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | tert-butyl N-(5-cyclopropyl-2-pyridinyl)carbamate;formic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C2CC2)cn1.O=CO |
| InChI | InChI=1S/C13H18N2O2.CH2O2/c1-13(2,3)17-12(16)15-11-7-6-10(8-14-11)9-4-5-9;2-1-3/h6-9H,4-5H2,1-3H3,(H,14,15,16);1H,(H,2,3) |
| InChIKey | GCXOGKIBMGXEMP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|