C20H27N5O5S — CID 140777161
ethyl 4-[2-[2-[5-(2-amino-4-pyridinyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethoxy]ethoxy]benzenecarboximidate (PubChem CID 140777161) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is ethyl 4-[2-[2-[5-(2-amino-4-pyridinyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethoxy]ethoxy]benzenecarboximidate.
| Compound Name | ethyl 4-[2-[2-[5-(2-amino-4-pyridinyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethoxy]ethoxy]benzenecarboximidate |
|---|---|
| PubChem CID | 140777161 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | ethyl 4-[2-[2-[5-(2-amino-4-pyridinyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethoxy]ethoxy]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1ccc(OCCOCCN2CCN(c3ccnc(N)c3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C20H27N5O5S/c1-2-29-20(22)16-3-5-18(6-4-16)30-14-13-28-12-11-24-9-10-25(31(24,26)27)17-7-8-23-19(21)15-17/h3-8,15,22H,2,9-14H2,1H3,(H2,21,23)/b22-20- |
| InChIKey | ORFHNIOGVKNUFZ-XDOYNYLZSA-N |
| XLogP | 1.49 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|