C24H27ClN4O3S — CID 118492119
4-[5-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine (PubChem CID 118492119) has the molecular formula C24H27ClN4O3S and a molecular weight of 487.03 g/mol. Its IUPAC name is 4-[5-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine.
| Compound Name | 4-[5-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 118492119 |
| Molecular Formula | C24H27ClN4O3S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[5-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
| SMILES | Nc1cc(N2CCN(CCCCCOc3ccc(-c4ccc(Cl)cc4)cc3)S2(=O)=O)ccn1 |
| InChI | InChI=1S/C24H27ClN4O3S/c25-21-8-4-19(5-9-21)20-6-10-23(11-7-20)32-17-3-1-2-14-28-15-16-29(33(28,30)31)22-12-13-27-24(26)18-22/h4-13,18H,1-3,14-17H2,(H2,26,27) |
| InChIKey | ZSMJSYLPPIPRCB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|