C24H26ClN3O3S — CID 118491918
2-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-5-pyridin-4-yl-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 118491918) has the molecular formula C24H26ClN3O3S and a molecular weight of 472.01 g/mol. Its IUPAC name is 2-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-5-pyridin-4-yl-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | 2-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-5-pyridin-4-yl-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 118491918 |
| Molecular Formula | C24H26ClN3O3S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-[5-[4-(4-chlorophenyl)phenoxy]pentyl]-5-pyridin-4-yl-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)N(CCCCCOc2ccc(-c3ccc(Cl)cc3)cc2)CCN1c1ccncc1 |
| InChI | InChI=1S/C24H26ClN3O3S/c25-22-8-4-20(5-9-22)21-6-10-24(11-7-21)31-19-3-1-2-16-27-17-18-28(32(27,29)30)23-12-14-26-15-13-23/h4-15H,1-3,16-19H2 |
| InChIKey | YOQDQHOCLOWOCY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|