C22H26N6O4S — CID 142734972
4-[5-[5-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazol-2-yl]pyridin-2-amine (PubChem CID 142734972) has the molecular formula C22H26N6O4S and a molecular weight of 470.56 g/mol. Its IUPAC name is 4-[5-[5-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazol-2-yl]pyridin-2-amine.
| Compound Name | 4-[5-[5-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazol-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 142734972 |
| Molecular Formula | C22H26N6O4S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-[5-[5-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazol-2-yl]pyridin-2-amine |
| SMILES | CCc1nnc(-c2ccc(OCCCCCN3C=CN(c4ccnc(N)c4)S3(=O)=O)cc2)o1 |
| InChI | InChI=1S/C22H26N6O4S/c1-2-21-25-26-22(32-21)17-6-8-19(9-7-17)31-15-5-3-4-12-27-13-14-28(33(27,29)30)18-10-11-24-20(23)16-18/h6-11,13-14,16H,2-5,12,15H2,1H3,(H2,23,24) |
| InChIKey | ABKPPOCLLJLPLW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|