C18H26N4O3 — CID 87013565
2-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl-methylamino]-N,N-dimethylacetamide (PubChem CID 87013565) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 87013565 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl-methylamino]-N,N-dimethylacetamide |
| SMILES | CCCCOc1ccc(-c2nnc(CN(C)CC(=O)N(C)C)o2)cc1 |
| InChI | InChI=1S/C18H26N4O3/c1-5-6-11-24-15-9-7-14(8-10-15)18-20-19-16(25-18)12-22(4)13-17(23)21(2)3/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | KIOOWIYKFBCXHW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|