C33H45FN2O4 — CID 23129603
[4-(5-decyl-1,3,4-oxadiazol-2-yl)phenyl] 3-fluoro-4-octoxybenzoate (PubChem CID 23129603) has the molecular formula C33H45FN2O4 and a molecular weight of 552.73 g/mol. Its IUPAC name is [4-(5-decyl-1,3,4-oxadiazol-2-yl)phenyl] 3-fluoro-4-octoxybenzoate.
| Compound Name | [4-(5-decyl-1,3,4-oxadiazol-2-yl)phenyl] 3-fluoro-4-octoxybenzoate |
|---|---|
| PubChem CID | 23129603 |
| Molecular Formula | C33H45FN2O4 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | [4-(5-decyl-1,3,4-oxadiazol-2-yl)phenyl] 3-fluoro-4-octoxybenzoate |
| SMILES | CCCCCCCCCCc1nnc(-c2ccc(OC(=O)c3ccc(OCCCCCCCC)c(F)c3)cc2)o1 |
| InChI | InChI=1S/C33H45FN2O4/c1-3-5-7-9-11-12-13-15-17-31-35-36-32(40-31)26-18-21-28(22-19-26)39-33(37)27-20-23-30(29(34)25-27)38-24-16-14-10-8-6-4-2/h18-23,25H,3-17,24H2,1-2H3 |
| InChIKey | ZNYXCCRWIMXFNY-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|