About 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride
3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride (PubChem CID 174976207) has the molecular formula C11H16ClN3O
and a molecular weight of 241.72 g/mol. Its IUPAC name is 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride |
| PubChem CID | 174976207 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride |
| SMILES | CC(C)O.Cl.[H]/N=C(\N)c1cccc(C#N)c1 |
| InChI | InChI=1S/C8H7N3.C3H8O.ClH/c9-5-6-2-1-3-7(4-6)8(10)11;1-3(2)4;/h1-4H,(H3,10,11);3-4H,1-2H3;1H |
| InChIKey | GUXFFIXTEQAIDF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride?
The IUPAC name of 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride (CID 174976207) is 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride.
What is the SMILES notation for 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride?
The canonical SMILES for 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride is CC(C)O.Cl.[H]/N=C(\N)c1cccc(C#N)c1.
What is the InChIKey of 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride?
The InChIKey is GUXFFIXTEQAIDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C3H8O.ClH/c9-5-6-2-1-3-7(4-6)8(10)11;1-3(2)4;/h1-4H,(H3,10,11);3-4H,1-2H3;1H.
What are the key properties of 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride?
3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride has a molecular weight of 241.72 g/mol, XLogP of 1.65, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanobenzenecarboximidamide;propan-2-ol;hydrochloride is sourced from PubChem (CID 174976207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).