C19H22N4O4 — CID 73173522
[2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] N-(3-carbamimidoylphenyl)carbamate (PubChem CID 73173522) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] N-(3-carbamimidoylphenyl)carbamate.
| Compound Name | [2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] N-(3-carbamimidoylphenyl)carbamate |
|---|---|
| PubChem CID | 73173522 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] N-(3-carbamimidoylphenyl)carbamate |
| SMILES | [H]/N=C(\N)c1cccc(NC(=O)OCC(=O)NC(C)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C19H22N4O4/c1-12(13-5-4-8-16(10-13)26-2)22-17(24)11-27-19(25)23-15-7-3-6-14(9-15)18(20)21/h3-10,12H,11H2,1-2H3,(H3,20,21)(H,22,24)(H,23,25) |
| InChIKey | ALZISPYCXWYSKJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|