C25H28N4O6 — CID 70298230
(3S)-3-[[(Z)-5-(4-carbamimidoylphenyl)pent-4-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid (PubChem CID 70298230) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is (3S)-3-[[(Z)-5-(4-carbamimidoylphenyl)pent-4-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(Z)-5-(4-carbamimidoylphenyl)pent-4-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70298230 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (3S)-3-[[(Z)-5-(4-carbamimidoylphenyl)pent-4-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(/C=C\CCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H28N4O6/c26-23(27)18-12-10-16(11-13-18)6-4-5-9-21(30)28-19(15-22(31)32)24(33)29-20(25(34)35)14-17-7-2-1-3-8-17/h1-4,6-8,10-13,19-20H,5,9,14-15H2,(H3,26,27)(H,28,30)(H,29,33)(H,31,32)(H,34,35)/b6-4-/t19-,20-/m0/s1 |
| InChIKey | YDJXDTNSRHZNRA-RXAWACCASA-N |
| XLogP | 1.54 |
| TPSA | 182.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|