C22H26ClN5O4 — CID 57040009
ethyl 3-[[3-[(4-carbamimidoylphenyl)carbamoylamino]-3-(4-chlorophenyl)propanoyl]amino]propanoate (PubChem CID 57040009) has the molecular formula C22H26ClN5O4 and a molecular weight of 459.93 g/mol. Its IUPAC name is ethyl 3-[[3-[(4-carbamimidoylphenyl)carbamoylamino]-3-(4-chlorophenyl)propanoyl]amino]propanoate.
| Compound Name | ethyl 3-[[3-[(4-carbamimidoylphenyl)carbamoylamino]-3-(4-chlorophenyl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 57040009 |
| Molecular Formula | C22H26ClN5O4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | ethyl 3-[[3-[(4-carbamimidoylphenyl)carbamoylamino]-3-(4-chlorophenyl)propanoyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)NC(CC(=O)NCCC(=O)OCC)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H26ClN5O4/c1-2-32-20(30)11-12-26-19(29)13-18(14-3-7-16(23)8-4-14)28-22(31)27-17-9-5-15(6-10-17)21(24)25/h3-10,18H,2,11-13H2,1H3,(H3,24,25)(H,26,29)(H2,27,28,31) |
| InChIKey | QLLCPHRGCCXTBD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 146.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|