C21H26N6O5 — CID 70074912
ethyl 3-[[2-[(4-carbamimidoylphenyl)carbamoylamino]-2-hydroxypropanoyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 70074912) has the molecular formula C21H26N6O5 and a molecular weight of 442.48 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-carbamimidoylphenyl)carbamoylamino]-2-hydroxypropanoyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl 3-[[2-[(4-carbamimidoylphenyl)carbamoylamino]-2-hydroxypropanoyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 70074912 |
| Molecular Formula | C21H26N6O5 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | ethyl 3-[[2-[(4-carbamimidoylphenyl)carbamoylamino]-2-hydroxypropanoyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)NC(C)(O)C(=O)NC(CC(=O)OCC)c2cccnc2)cc1 |
| InChI | InChI=1S/C21H26N6O5/c1-3-32-17(28)11-16(14-5-4-10-24-12-14)26-19(29)21(2,31)27-20(30)25-15-8-6-13(7-9-15)18(22)23/h4-10,12,16,31H,3,11H2,1-2H3,(H3,22,23)(H,26,29)(H2,25,27,30) |
| InChIKey | YBECGGPXAYPVPV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 179.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|