C24H24N6O4 — CID 22851743
(3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-2-phenylacetyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 22851743) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is (3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-2-phenylacetyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | (3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-2-phenylacetyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 22851743 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-2-phenylacetyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)N[C@H](C(=O)N[C@H](CC(=O)O)c2cccnc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N6O4/c25-22(26)16-8-10-18(11-9-16)28-24(34)30-21(15-5-2-1-3-6-15)23(33)29-19(13-20(31)32)17-7-4-12-27-14-17/h1-12,14,19,21H,13H2,(H3,25,26)(H,29,33)(H,31,32)(H2,28,30,34)/t19-,21+/m1/s1 |
| InChIKey | ZGDCKCDPBHLGQA-CTNGQTDRSA-N |
| XLogP | 2.56 |
| TPSA | 170.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|