C22H28N6O4 — CID 22851742
(3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-4-methylpentanoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 22851742) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-4-methylpentanoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | (3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-4-methylpentanoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 22851742 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (3R)-3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]-4-methylpentanoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(=O)O)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H28N6O4/c1-13(2)10-18(28-22(32)26-16-7-5-14(6-8-16)20(23)24)21(31)27-17(11-19(29)30)15-4-3-9-25-12-15/h3-9,12-13,17-18H,10-11H2,1-2H3,(H3,23,24)(H,27,31)(H,29,30)(H2,26,28,32)/t17-,18+/m1/s1 |
| InChIKey | XBFQEAKFQBOOQN-MSOLQXFVSA-N |
| XLogP | 2.23 |
| TPSA | 170.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|