C21H26N6O4 — CID 54457783
ethyl 3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]propanoyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 54457783) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is ethyl 3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]propanoyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl 3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]propanoyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 54457783 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | ethyl 3-[[(2S)-2-[(4-carbamimidoylphenyl)carbamoylamino]propanoyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)N[C@@H](C)C(=O)NC(CC(=O)OCC)c2cccnc2)cc1 |
| InChI | InChI=1S/C21H26N6O4/c1-3-31-18(28)11-17(15-5-4-10-24-12-15)27-20(29)13(2)25-21(30)26-16-8-6-14(7-9-16)19(22)23/h4-10,12-13,17H,3,11H2,1-2H3,(H3,22,23)(H,27,29)(H2,25,26,30)/t13-,17?/m0/s1 |
| InChIKey | WZLCUBQDHFHIOE-CWQZNGJJSA-N |
| XLogP | 1.69 |
| TPSA | 159.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|