C17H21N3O3 — CID 124640185
ethyl (3S,5R)-5-(hydroxyamino)-3,5-dipyridin-3-ylpentanoate (PubChem CID 124640185) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl (3S,5R)-5-(hydroxyamino)-3,5-dipyridin-3-ylpentanoate.
| Compound Name | ethyl (3S,5R)-5-(hydroxyamino)-3,5-dipyridin-3-ylpentanoate |
|---|---|
| PubChem CID | 124640185 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | ethyl (3S,5R)-5-(hydroxyamino)-3,5-dipyridin-3-ylpentanoate |
| SMILES | CCOC(=O)C[C@H](C[C@@H](NO)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C17H21N3O3/c1-2-23-17(21)10-15(13-5-3-7-18-11-13)9-16(20-22)14-6-4-8-19-12-14/h3-8,11-12,15-16,20,22H,2,9-10H2,1H3/t15-,16+/m0/s1 |
| InChIKey | BUUYBQRNWSZIKB-JKSUJKDBSA-N |
| XLogP | 2.62 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|