C14H22N2O3 — CID 174510625
5,5-diethoxy-3-pyridin-3-ylpentanamide (PubChem CID 174510625) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 5,5-diethoxy-3-pyridin-3-ylpentanamide.
| Compound Name | 5,5-diethoxy-3-pyridin-3-ylpentanamide |
|---|---|
| PubChem CID | 174510625 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 5,5-diethoxy-3-pyridin-3-ylpentanamide |
| SMILES | CCOC(CC(CC(N)=O)c1cccnc1)OCC |
| InChI | InChI=1S/C14H22N2O3/c1-3-18-14(19-4-2)9-12(8-13(15)17)11-6-5-7-16-10-11/h5-7,10,12,14H,3-4,8-9H2,1-2H3,(H2,15,17) |
| InChIKey | KSAIILGQEIDUPJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|