C11H16N2O2 — CID 81405022
ethyl 2-[[(1S)-1-pyridin-3-ylethyl]amino]acetate (PubChem CID 81405022) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is ethyl 2-[[(1S)-1-pyridin-3-ylethyl]amino]acetate.
| Compound Name | ethyl 2-[[(1S)-1-pyridin-3-ylethyl]amino]acetate |
|---|---|
| PubChem CID | 81405022 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | ethyl 2-[[(1S)-1-pyridin-3-ylethyl]amino]acetate |
| SMILES | CCOC(=O)CN[C@@H](C)c1cccnc1 |
| InChI | InChI=1S/C11H16N2O2/c1-3-15-11(14)8-13-9(2)10-5-4-6-12-7-10/h4-7,9,13H,3,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | SRYALRFCDUSZRA-VIFPVBQESA-N |
| XLogP | 1.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |