C19H26N6O4 — CID 15389505
3-[[4-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]-4-oxobutanoyl]amino]-3-pyridin-2-ylpropanoic acid (PubChem CID 15389505) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-[[4-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]-4-oxobutanoyl]amino]-3-pyridin-2-ylpropanoic acid.
| Compound Name | 3-[[4-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]-4-oxobutanoyl]amino]-3-pyridin-2-ylpropanoic acid |
|---|---|
| PubChem CID | 15389505 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-[[4-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]-4-oxobutanoyl]amino]-3-pyridin-2-ylpropanoic acid |
| SMILES | [H]/N=C(\N)N1CC=C(CCNC(=O)CCC(=O)NC(CC(=O)O)c2ccccn2)C1 |
| InChI | InChI=1S/C19H26N6O4/c20-19(21)25-10-7-13(12-25)6-9-23-16(26)4-5-17(27)24-15(11-18(28)29)14-3-1-2-8-22-14/h1-3,7-8,15H,4-6,9-12H2,(H3,20,21)(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | HLALFIHHDRWHMR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|