C22H28N4O4 — CID 70155931
3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-cyclohexylpropanoic acid (PubChem CID 70155931) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-cyclohexylpropanoic acid.
| Compound Name | 3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-cyclohexylpropanoic acid |
|---|---|
| PubChem CID | 70155931 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-cyclohexylpropanoic acid |
| SMILES | N#Cc1ccc(N2CCN(CC(=O)NC(CC(=O)O)C3CCCCC3)C(=O)C2)cc1 |
| InChI | InChI=1S/C22H28N4O4/c23-13-16-6-8-18(9-7-16)25-10-11-26(21(28)15-25)14-20(27)24-19(12-22(29)30)17-4-2-1-3-5-17/h6-9,17,19H,1-5,10-12,14-15H2,(H,24,27)(H,29,30) |
| InChIKey | SFPMRIKMOVNOHT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |