C21H29N5O6 — CID 56981184
methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]acetyl]amino]propanoate (PubChem CID 56981184) has the molecular formula C21H29N5O6 and a molecular weight of 447.49 g/mol. Its IUPAC name is methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]acetyl]amino]propanoate.
| Compound Name | methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 56981184 |
| Molecular Formula | C21H29N5O6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]acetyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2=C(CC(=O)NC[C@@H](NC(=O)OCCCC)C(=O)OC)CON2)cc1 |
| InChI | InChI=1S/C21H29N5O6/c1-3-4-9-31-21(29)25-16(20(28)30-2)11-24-17(27)10-15-12-32-26-18(15)13-5-7-14(8-6-13)19(22)23/h5-8,16,26H,3-4,9-12H2,1-2H3,(H3,22,23)(H,24,27)(H,25,29)/t16-/m1/s1 |
| InChIKey | GIHKFSMLYXKVKJ-MRXNPFEDSA-N |
| XLogP | 0.79 |
| TPSA | 164.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|