C21H26N4O6 — CID 59094827
methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[(5R)-3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate (PubChem CID 59094827) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[(5R)-3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate.
| Compound Name | methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[(5R)-3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 59094827 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | methyl (2R)-2-(butoxycarbonylamino)-3-[[2-[(5R)-3-(4-isocyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
| SMILES | [C-]#[N+]c1ccc(C2=NO[C@@H](CC(=O)NC[C@@H](NC(=O)OCCCC)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C21H26N4O6/c1-4-5-10-30-21(28)24-18(20(27)29-3)13-23-19(26)12-16-11-17(25-31-16)14-6-8-15(22-2)9-7-14/h6-9,16,18H,4-5,10-13H2,1,3H3,(H,23,26)(H,24,28)/t16-,18-/m1/s1 |
| InChIKey | RUOPTOJDXVJOEN-SJLPKXTDSA-N |
| XLogP | 2.30 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|