About propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate
propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate (PubChem CID 139808553) has the molecular formula C23H27N3O6S
and a molecular weight of 473.55 g/mol. Its IUPAC name is propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate.
Molecular Properties
| Compound Name | propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate |
| PubChem CID | 139808553 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](CNC(=O)CCCOc1ccc(C#N)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O6S/c1-17(2)32-23(28)21(26-33(29,30)20-7-4-3-5-8-20)16-25-22(27)9-6-14-31-19-12-10-18(15-24)11-13-19/h3-5,7-8,10-13,17,21,26H,6,9,14,16H2,1-2H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | VCCYLGZVELQLAX-NRFANRHFSA-N |
| XLogP | 2.13 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate?
The IUPAC name of propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate (CID 139808553) is propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate.
What is the SMILES notation for propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate?
The canonical SMILES for propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate is CC(C)OC(=O)[C@H](CNC(=O)CCCOc1ccc(C#N)cc1)NS(=O)(=O)c1ccccc1.
What is the InChIKey of propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate?
The InChIKey is VCCYLGZVELQLAX-NRFANRHFSA-N. The full InChI is InChI=1S/C23H27N3O6S/c1-17(2)32-23(28)21(26-33(29,30)20-7-4-3-5-8-20)16-25-22(27)9-6-14-31-19-12-10-18(15-24)11-13-19/h3-5,7-8,10-13,17,21,26H,6,9,14,16H2,1-2H3,(H,25,27)/t21-/m0/s1.
What are the key properties of propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate?
propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate has a molecular weight of 473.55 g/mol, XLogP of 2.13, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-2-(benzenesulfonamido)-3-[4-(4-cyanophenoxy)butanoylamino]propanoate is sourced from PubChem (CID 139808553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).