C21H22N4O6S — CID 18369650
methyl 3-[[2-[(E)-(4-cyanophenyl)methylideneamino]oxyacetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate (PubChem CID 18369650) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is methyl 3-[[2-[(E)-(4-cyanophenyl)methylideneamino]oxyacetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[[2-[(E)-(4-cyanophenyl)methylideneamino]oxyacetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 18369650 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | methyl 3-[[2-[(E)-(4-cyanophenyl)methylideneamino]oxyacetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(CNC(=O)CO/N=C/c1ccc(C#N)cc1)NS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C21H22N4O6S/c1-15-4-3-5-18(10-15)32(28,29)25-19(21(27)30-2)13-23-20(26)14-31-24-12-17-8-6-16(11-22)7-9-17/h3-10,12,19,25H,13-14H2,1-2H3,(H,23,26)/b24-12+ |
| InChIKey | IQYFPPSMAFMWAY-WYMPLXKRSA-N |
| XLogP | 0.85 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|