C15H17N3O4S — CID 167887695
methyl 2-[(3-methylphenyl)sulfonylamino]-3-pyrimidin-2-ylpropanoate (PubChem CID 167887695) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl 2-[(3-methylphenyl)sulfonylamino]-3-pyrimidin-2-ylpropanoate.
| Compound Name | methyl 2-[(3-methylphenyl)sulfonylamino]-3-pyrimidin-2-ylpropanoate |
|---|---|
| PubChem CID | 167887695 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl 2-[(3-methylphenyl)sulfonylamino]-3-pyrimidin-2-ylpropanoate |
| SMILES | COC(=O)C(Cc1ncccn1)NS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C15H17N3O4S/c1-11-5-3-6-12(9-11)23(20,21)18-13(15(19)22-2)10-14-16-7-4-8-17-14/h3-9,13,18H,10H2,1-2H3 |
| InChIKey | OWGWNVZGFXFKBD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |