C12H14N2O5S — CID 103916486
methyl 2-[(4-cyano-2-methylphenyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 103916486) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is methyl 2-[(4-cyano-2-methylphenyl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(4-cyano-2-methylphenyl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 103916486 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | methyl 2-[(4-cyano-2-methylphenyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NS(=O)(=O)c1ccc(C#N)cc1C |
| InChI | InChI=1S/C12H14N2O5S/c1-8-5-9(6-13)3-4-11(8)20(17,18)14-10(7-15)12(16)19-2/h3-5,10,14-15H,7H2,1-2H3 |
| InChIKey | NDXNHVAULVWYEB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |