C16H23NO7S — CID 54114228
tert-butyl 4-[[(2S)-3-hydroxy-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-3-methylbenzoate (PubChem CID 54114228) has the molecular formula C16H23NO7S and a molecular weight of 373.43 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-3-hydroxy-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-3-methylbenzoate.
| Compound Name | tert-butyl 4-[[(2S)-3-hydroxy-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 54114228 |
| Molecular Formula | C16H23NO7S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | tert-butyl 4-[[(2S)-3-hydroxy-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-3-methylbenzoate |
| SMILES | COC(=O)[C@H](CO)NS(=O)(=O)c1ccc(C(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C16H23NO7S/c1-10-8-11(14(19)24-16(2,3)4)6-7-13(10)25(21,22)17-12(9-18)15(20)23-5/h6-8,12,17-18H,9H2,1-5H3/t12-/m0/s1 |
| InChIKey | NJFKKWGESHBFAM-LBPRGKRZSA-N |
| XLogP | 0.76 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |