C12H15NO7S — CID 43624280
methyl 4-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoate (PubChem CID 43624280) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is methyl 4-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoate.
| Compound Name | methyl 4-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43624280 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | methyl 4-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC(CO)C(=O)OC)cc1 |
| InChI | InChI=1S/C12H15NO7S/c1-19-11(15)8-3-5-9(6-4-8)21(17,18)13-10(7-14)12(16)20-2/h3-6,10,13-14H,7H2,1-2H3 |
| InChIKey | CDYIMOHUGSPVAZ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |