C14H19NO6S — CID 119142039
2-[(4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 119142039) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-[(4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119142039 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[(4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC(CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO6S/c1-9(2)8-12(13(16)17)15-22(19,20)11-6-4-10(5-7-11)14(18)21-3/h4-7,9,12,15H,8H2,1-3H3,(H,16,17) |
| InChIKey | XEMZBQXRLKLNOE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |