C20H28N2O5S2 — CID 19794921
methanesulfonic acid;4-[5-(2-methoxyphenyl)sulfanylpentoxy]benzenecarboximidamide (PubChem CID 19794921) has the molecular formula C20H28N2O5S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is methanesulfonic acid;4-[5-(2-methoxyphenyl)sulfanylpentoxy]benzenecarboximidamide.
| Compound Name | methanesulfonic acid;4-[5-(2-methoxyphenyl)sulfanylpentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 19794921 |
| Molecular Formula | C20H28N2O5S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methanesulfonic acid;4-[5-(2-methoxyphenyl)sulfanylpentoxy]benzenecarboximidamide |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1ccc(OCCCCCSc2ccccc2OC)cc1 |
| InChI | InChI=1S/C19H24N2O2S.CH4O3S/c1-22-17-7-3-4-8-18(17)24-14-6-2-5-13-23-16-11-9-15(10-12-16)19(20)21;1-5(2,3)4/h3-4,7-12H,2,5-6,13-14H2,1H3,(H3,20,21);1H3,(H,2,3,4) |
| InChIKey | OPEWDERTGCFJNY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|