C22H31FN2O6S — CID 19794927
4-[5-(5-fluoro-2-propan-2-yloxyphenoxy)pentoxy]benzenecarboximidamide;methanesulfonic acid (PubChem CID 19794927) has the molecular formula C22H31FN2O6S and a molecular weight of 470.56 g/mol. Its IUPAC name is 4-[5-(5-fluoro-2-propan-2-yloxyphenoxy)pentoxy]benzenecarboximidamide;methanesulfonic acid.
| Compound Name | 4-[5-(5-fluoro-2-propan-2-yloxyphenoxy)pentoxy]benzenecarboximidamide;methanesulfonic acid |
|---|---|
| PubChem CID | 19794927 |
| Molecular Formula | C22H31FN2O6S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[5-(5-fluoro-2-propan-2-yloxyphenoxy)pentoxy]benzenecarboximidamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1ccc(OCCCCCOc2cc(F)ccc2OC(C)C)cc1 |
| InChI | InChI=1S/C21H27FN2O3.CH4O3S/c1-15(2)27-19-11-8-17(22)14-20(19)26-13-5-3-4-12-25-18-9-6-16(7-10-18)21(23)24;1-5(2,3)4/h6-11,14-15H,3-5,12-13H2,1-2H3,(H3,23,24);1H3,(H,2,3,4) |
| InChIKey | GZEPDUJVQBHGPK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|