C17H16I3NO4S — CID 4829259
(2,4,6-triiodophenyl) 4-(diethylsulfamoyl)benzoate (PubChem CID 4829259) has the molecular formula C17H16I3NO4S and a molecular weight of 711.10 g/mol. Its IUPAC name is (2,4,6-triiodophenyl) 4-(diethylsulfamoyl)benzoate.
| Compound Name | (2,4,6-triiodophenyl) 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4829259 |
| Molecular Formula | C17H16I3NO4S |
| Molecular Weight | 711.10 g/mol |
| Exact Mass | 710.79 |
| IUPAC Name | (2,4,6-triiodophenyl) 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Oc2c(I)cc(I)cc2I)cc1 |
| InChI | InChI=1S/C17H16I3NO4S/c1-3-21(4-2)26(23,24)13-7-5-11(6-8-13)17(22)25-16-14(19)9-12(18)10-15(16)20/h5-10H,3-4H2,1-2H3 |
| InChIKey | KVDWCUVFFJEXOF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.10 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|