C26H23I4NO6S — CID 57016981
[4-(4-hydroxy-3,5-diiodobenzoyl)-2,6-diiodophenyl] 4-(dipropylsulfamoyl)benzoate (PubChem CID 57016981) has the molecular formula C26H23I4NO6S and a molecular weight of 985.15 g/mol. Its IUPAC name is [4-(4-hydroxy-3,5-diiodobenzoyl)-2,6-diiodophenyl] 4-(dipropylsulfamoyl)benzoate.
| Compound Name | [4-(4-hydroxy-3,5-diiodobenzoyl)-2,6-diiodophenyl] 4-(dipropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 57016981 |
| Molecular Formula | C26H23I4NO6S |
| Molecular Weight | 985.15 g/mol |
| Exact Mass | 984.74 |
| IUPAC Name | [4-(4-hydroxy-3,5-diiodobenzoyl)-2,6-diiodophenyl] 4-(dipropylsulfamoyl)benzoate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Oc2c(I)cc(C(=O)c3cc(I)c(O)c(I)c3)cc2I)cc1 |
| InChI | InChI=1S/C26H23I4NO6S/c1-3-9-31(10-4-2)38(35,36)18-7-5-15(6-8-18)26(34)37-25-21(29)13-17(14-22(25)30)23(32)16-11-19(27)24(33)20(28)12-16/h5-8,11-14,33H,3-4,9-10H2,1-2H3 |
| InChIKey | GZSXEOWTGRSHPS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.15 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|