C24H31N3O4S2 — CID 16873970
[2-(diethylamino)-1,3-benzothiazol-6-yl] 4-(dipropylsulfamoyl)benzoate (PubChem CID 16873970) has the molecular formula C24H31N3O4S2 and a molecular weight of 489.66 g/mol. Its IUPAC name is [2-(diethylamino)-1,3-benzothiazol-6-yl] 4-(dipropylsulfamoyl)benzoate.
| Compound Name | [2-(diethylamino)-1,3-benzothiazol-6-yl] 4-(dipropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16873970 |
| Molecular Formula | C24H31N3O4S2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [2-(diethylamino)-1,3-benzothiazol-6-yl] 4-(dipropylsulfamoyl)benzoate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Oc2ccc3nc(N(CC)CC)sc3c2)cc1 |
| InChI | InChI=1S/C24H31N3O4S2/c1-5-15-27(16-6-2)33(29,30)20-12-9-18(10-13-20)23(28)31-19-11-14-21-22(17-19)32-24(25-21)26(7-3)8-4/h9-14,17H,5-8,15-16H2,1-4H3 |
| InChIKey | IWDRNFAMRPBWDI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|