C14H10Cl2O3S — CID 3008749
1-[4-(benzenesulfonyl)phenyl]-2,2-dichloroethanone (PubChem CID 3008749) has the molecular formula C14H10Cl2O3S and a molecular weight of 329.20 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)phenyl]-2,2-dichloroethanone.
| Compound Name | 1-[4-(benzenesulfonyl)phenyl]-2,2-dichloroethanone |
|---|---|
| PubChem CID | 3008749 |
| Molecular Formula | C14H10Cl2O3S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 1-[4-(benzenesulfonyl)phenyl]-2,2-dichloroethanone |
| SMILES | O=C(c1ccc(S(=O)(=O)c2ccccc2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C14H10Cl2O3S/c15-14(16)13(17)10-6-8-12(9-7-10)20(18,19)11-4-2-1-3-5-11/h1-9,14H |
| InChIKey | LOHMAYZFXZBLBF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|