C14H21NO2S — CID 79581498
2-[2-(2-methylphenyl)sulfonylethyl]cyclopentan-1-amine (PubChem CID 79581498) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-[2-(2-methylphenyl)sulfonylethyl]cyclopentan-1-amine.
| Compound Name | 2-[2-(2-methylphenyl)sulfonylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 79581498 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[2-(2-methylphenyl)sulfonylethyl]cyclopentan-1-amine |
| SMILES | Cc1ccccc1S(=O)(=O)CCC1CCCC1N |
| InChI | InChI=1S/C14H21NO2S/c1-11-5-2-3-8-14(11)18(16,17)10-9-12-6-4-7-13(12)15/h2-3,5,8,12-13H,4,6-7,9-10,15H2,1H3 |
| InChIKey | YFKWRLYQJANVCX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |