C13H17BrO2S — CID 67130389
1-bromo-3-(cyclohexylmethylsulfonyl)benzene (PubChem CID 67130389) has the molecular formula C13H17BrO2S and a molecular weight of 317.25 g/mol. Its IUPAC name is 1-bromo-3-(cyclohexylmethylsulfonyl)benzene.
| Compound Name | 1-bromo-3-(cyclohexylmethylsulfonyl)benzene |
|---|---|
| PubChem CID | 67130389 |
| Molecular Formula | C13H17BrO2S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-bromo-3-(cyclohexylmethylsulfonyl)benzene |
| SMILES | O=S(=O)(CC1CCCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrO2S/c14-12-7-4-8-13(9-12)17(15,16)10-11-5-2-1-3-6-11/h4,7-9,11H,1-3,5-6,10H2 |
| InChIKey | REUCXFRXDCRSSW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |