C17H25NO3S — CID 67130265
4-amino-1-[3-(cyclohexylmethylsulfonyl)phenyl]butan-2-one (PubChem CID 67130265) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-amino-1-[3-(cyclohexylmethylsulfonyl)phenyl]butan-2-one.
| Compound Name | 4-amino-1-[3-(cyclohexylmethylsulfonyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 67130265 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-amino-1-[3-(cyclohexylmethylsulfonyl)phenyl]butan-2-one |
| SMILES | NCCC(=O)Cc1cccc(S(=O)(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C17H25NO3S/c18-10-9-16(19)11-15-7-4-8-17(12-15)22(20,21)13-14-5-2-1-3-6-14/h4,7-8,12,14H,1-3,5-6,9-11,13,18H2 |
| InChIKey | MPYYZDDWUIFNNL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |